RAD16-I (hydrochloride) [CAS 2100275-49-6]
Partner: MedChemexpress LLC
| CAS No: | 2100275-49-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | N/A |
| Formula: | C66H113N29O25.xHCl |
| SMILES: | NC([C@H](C)NC([C@H](CC(O)=O)NC([C@H](C)NC([C@H](CCCNC(N)=N)NC([C@H](C)NC([C@H](CC(O)=O)NC([C@H](C)NC([C@H](CCCNC(N)=N)NC([C@H](C)NC([C@H](CC(O)=O)NC([C@H](C)NC([C@H](CCCNC(N)=N)NC([C@H](C)NC([C@H](CC(O)=O)NC([C@H](C)NC([C@@H](NC(C)=O)CCCNC(N)=N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.Cl |
| Purity: | 96.81 |
| Description: | RAD16-I hydrochloride, a soft nanofibrous self-assembling peptide, is a suitable microenvironment for human mesenchymal stem cells’ (hMSC) proliferation and differentiation into chondrocytes[1]. RAD16-I is a well-studied ionic complementary peptide was used as a model to check potential amyloid-like staining properties of SAPNFs[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
