mTRP-2 (180-188) [CAS 219312-69-3]
Partner: MedChemexpress LLC
| CAS No: | 219312-69-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 1175.33 |
| Formula: | C61H78N10O14 |
| SMILES: | CC(C)C[C@@H](C(O)=O)NC([C@H](CC1=CNC2=C1C=CC=C2)NC([C@H](C(C)C)NC([C@H](CC3=CC=CC=C3)NC([C@H](CC4=CC=CC=C4)NC([C@H](CC(O)=O)NC([C@H](CC5=CC=C(O)C=C5)NC([C@H](C(C)C)NC([C@H](CO)N)=O)=O)=O)=O)=O)=O)=O)=O |
| Purity: | 99.52 |
| Description: | mTRP-2 (180-188) is a murine tyrosinase-related protein 2 (TRP-2) -derived peptide, corresponding to residues 180-188. TRP-2 (180-188) is identified as the major reactive epitope within TRP-2 recognized by anti-B16 CTLs[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
