[Sar9] Substance P [CAS 77128-75-7]
Partner: MedChemexpress LLC
| CAS No: | 77128-75-7 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 1361.66 |
| Formula: | C64H100N18O13S |
| SMILES: | O=C([C@H]1N(CCC1)C([C@@H](N)CCCNC(N)=N)=O)N[C@@H](CCCCN)C(N2[C@@H](CCC2)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(N)=O)C(N[C@H](C(N[C@H](C(N(C)CC(N[C@@H](CC(C)C)C(N[C@H](C(N)=O)CCSC)=O)=O)=O)CC3=CC=CC=C3)=O)CC4=CC=CC=C4)=O)=O)=O)=O |
| Purity: | 99.82 |
| Description: | [Sar9] Substance P is a potent and selective neurokinin (NK)-1 receptor agonist[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
