Mini Gastrin I, human (TFA)
Partner: MedChemexpress LLC
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 1760.75 |
| Formula: | C76H100F3N15O28S |
| SMILES: | O=C(O)C(F)(F)F.O=C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](C)C(N[C@@H](CC1=CC=C(C=C1)O)C(NCC(N[C@@H](CC2=CNC3=CC=CC=C23)C(N[C@@H](CCSC)C(N[C@@H](CC(O)=O)C(N[C@@H](CC4=CC=CC=C4)C(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC(C)C)N |
| Purity: | 99.09 |
| Description: | Mini Gastrin I, human (TFA) is a shorter version of human gastrin, consists of amino acids 5-17 of the parent peptide. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
