Prolactin Releasing Peptide (12-31), human [CAS 235433-36-0]
Partner: MedChemexpress LLC
| CAS No: | 235433-36-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 2272.57 |
| Formula: | C104H158N32O26 |
| SMILES: | OC(C=C1)=CC=C1C[C@@H](C(N[C@@H](C)C(N[C@@H](CO)C(N[C@@H](CCCNC(N)=N)C(NCC(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@@H](C(C)C)C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@H](C(N)=O)CC3=CC=CC=C3)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)NC([C@@H](NC([C@H](C)NC([C@H]4N(CCC4)C([C@H](CC(N)=O)NC([C@H]([C@@H](C)CC)NC([C@H](CC(O)=O)NC([C@H]5N(CCC5)C([C@@H](N)[C@H](O)C)=O)=O)=O)=O)=O)=O)=O)CC6=CNC7=CC=CC=C67)=O |
| Purity: | 98.85 |
| Description: | Prolactin Releasing Peptide (12-31), human is a fragment of the prolactin releasing peptide (PrRP). Prolactin Releasing Peptide (1-31), human is a high affinity GPR10 ligand that cause the release of the prolactin. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
