Z-VRPR-FMK (TFA)
Partner: MedChemexpress LLC
| Applications: | COVID-19-anti-virus |
| MW: | 790.81 |
| Formula: | C33H50F4N10O8 |
| SMILES: | OC(C(F)(F)F)=O.CC([C@@H](C(N[C@H](C(N1CCC[C@H]1C(NC(C(CF)=O)CCCNC(N)=N)=O)=O)CCCNC(N)=N)=O)NC(OCC2=CC=CC=C2)=O)C |
| Purity: | 95.92 |
| Description: | Z-VRPR-FMK (TFA) (VRPR), a tetrapeptide, is a selective and irreversible MALT1 (Mucosa-associated lymphoid tissue lymphoma translocation protein 1) inhibitor. Z-VRPR-FMK (TFA) can protect against influenza A virus (IAV) infection[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
