Ac9-25 [CAS 284040-76-2]
Partner: MedChemexpress LLC
| CAS No: | 284040-76-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 2183.33 |
| Formula: | C99H143N23O33 |
| SMILES: | O=C(N[C@@H](C)C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](CC3=CC=CC=C3)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC(N)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC4=CC=C(C=C4)O)C(N[C@@H](C(C)C)C(N[C@@H](CCC(N)=O)C(N[C@@H]([C@H](O)C)C(N[C@@H](C(C)C)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCC(NC(O)=O)=O)N.OC(C(F)(F)F)=O |
| Purity: | 98.54 |
| Description: | Ac9-25, a N-terminal peptide of Annexin I, acts as a formyl peptide receptor (FPR) agonist and activates the neutrophil NADPH oxidase through FPR[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
