[Leu5]-Enkephalin [CAS 58822-25-6]
Partner: MedChemexpress LLC
| CAS No: | 58822-25-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 555.62 |
| Formula: | C28H37N5O7 |
| SMILES: | CC(C)C[C@@H](C(O)=O)NC([C@H](CC1=CC=CC=C1)NC(CNC(CNC([C@H](CC2=CC=C(C=C2)O)N)=O)=O)=O)=O |
| Purity: | 99.87 |
| Description: | [Leu5]-Enkephalin is a pentapeptide with morphine like properties. [Leu5]-Enkephalin is a five amino acid endogenous peptide that acts as an agonist at opioid receptors. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
