Mu C5AC motif peptide [CAS 244049-41-0]
Partner: MedChemexpress LLC
| CAS No: | 244049-41-0 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1501.62 |
| Formula: | C63H104N16O26 |
| SMILES: | O=C(N[C@@H]([C@H](O)C)C(N[C@@H]([C@H](O)C)C(N1[C@@H](CCC1)C(N[C@@H](CO)C(N2[C@@H](CCC2)C(N[C@@H](C(C)C)C(N3[C@@H](CCC3)C(N[C@@H]([C@H](O)C)C(N[C@@H]([C@H](O)C)C(N[C@@H](CO)C(N[C@@H]([C@H](O)C)C(N[C@@H]([C@H](O)C)C(N[C@@H](CO)C(N[C@@H](C)C(N4[C@@H](CCC4)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CN |
| Purity: | 98.79 |
| Description: | MUC5AC motif peptide is a 16-amino acid fragment of mucin 5. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
