N-Formyl-Met-Leu-Phe [CAS 59880-97-6]
Partner: MedChemexpress LLC
| CAS No: | 59880-97-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 437.55 |
| Formula: | C21H31N3O5S |
| SMILES: | O=C(O)[C@H](CC1=CC=CC=C1)NC([C@H](CC(C)C)NC([C@H](CCSC)NC=O)=O)=O |
| Purity: | 99.83 |
| Description: | N-Formyl-Met-Leu-Phe (fMLP; N-Formyl-MLF) is a chemotactic peptide and a specific ligand of N-formyl peptide receptor (FPR). N-Formyl-Met-Leu-Ph is reported to inhibit TNF-alpha secretion. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
