Z-WEHD-FMK [CAS 210345-00-9]
Partner: MedChemexpress LLC
| CAS No: | 210345-00-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 763.77 |
| Formula: | C37H42FN7O10 |
| SMILES: | O=C(N[C@@H](CCC(OC)=O)C(N[C@H](C(N[C@H](C(CF)=O)CC(OC)=O)=O)CC1=CN=CN1)=O)[C@@H](NC(OCC2=CC=CC=C2)=O)CC3=CNC4=C3C=CC=C4 |
| Purity: | 98.0 |
| Description: | Z-WEHD-FMK is a potent, cell-permeable and irreversible caspase-1/5 inhibitor. Z-WEHD-FMK also exhibits a robust inhibitory effect on cathepsin B activity (IC50=6 ?M). Z-WEHD-FMK can be used to investigate cells for evidence of apoptosis[1][2][4]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
