Withanoside V [CAS 256520-90-8]
Partner: MedChemexpress LLC
| CAS No: | 256520-90-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 766.91 |
| Formula: | C40H62O14 |
| SMILES: | C[C@]1(CC2)[C@](CC[C@]1([H])[C@@H]([C@@](OC3=O)([H])CC(C)=C3C)C)([H])[C@@](CC=C4C[C@H]5O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]([C@H]6O)CO[C@@H]([C@@H]([C@H]7O)O)O[C@@H]([C@H]7O)CO)([H])[C@@]2([H])[C@]4([C@H](C5)O)C |
| Description: | Withanoside V, a withanolide glycoside, exhibits inhibitory activity for tachyphylaxis to Clonidine in isolated guinea-pig ileum[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
