19,20-Epoxycytochalasin C [CAS 189351-79-9]
Partner: MedChemexpress LLC
| CAS No: | 189351-79-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 523.62 |
| Formula: | C30H37NO7 |
| SMILES: | CC(O[C@H]([C@@]1([H])[C@@]([C@@](O)(C2=O)C)([H])O1)[C@@]([C@](/C=C/C[C@@H]2C)([H])[C@@H]3O)(C(N4)=O)[C@](C(C)=C3C)([H])[C@@H]4CC5=CC=CC=C5)=O |
| Description: | 19,20-Epoxycytochalasin C, a cytochalasin, is a fungal metabolite from Nemania sp. 19,20-Epoxycytochalasin C shows potent in vitro antiplasmodial activity and phytotoxicity[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
