D-Pentamannuronic acid [CAS 183668-50-0]
Partner: MedChemexpress LLC
| CAS No: | 183668-50-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 898.64 |
| Formula: | C30H42O31 |
| SMILES: | OC([C@@H](O[C@H]1O[C@@H]([C@@H]([C@@H]2O)O)[C@H](O[C@H]2O[C@@H]([C@@H]([C@@H]3O)O)[C@H](O[C@H]3O)C(O)=O)C(O)=O)[C@H]([C@@H]([C@@H]1O)O)O[C@@H]([C@H]([C@H]4O)O)O[C@@H]([C@H]4O[C@@H]([C@H]([C@H]5O)O)O[C@@H]([C@H]5O)C(O)=O)C(O)=O)=O |
| Purity: | 97.0 |
| Description: | D-Pentamannuronic acid, an alginate oligomer, is produced by marine brown algae and by a limited range of Gram negative bacteria. D-Pentamannuronic acid can be used for the research of pain and vascular dementia[1][2][3][4]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
