Physalin F [CAS 57423-71-9]
Partner: MedChemexpress LLC
| CAS No: | 57423-71-9 |
| Applications: | COVID-19-anti-virus |
| MW: | 526.53 |
| Formula: | C28H30O10 |
| SMILES: | C[C@@]([C@@](OC1=O)([H])C2)(OC3=O)[C@@]([C@@]3(CC[C@@]4([H])[C@@]5([H])C[C@@H](O6)[C@]6(CC=C7)[C@@]4(C7=O)C)O)(O[C@@]58C9=O)[C@]9([H])[C@]2([C@@]1([H])CO8)C |
| Purity: | 98.0 |
| Description: | Physalin F is a secosteroid with potent anti-inflammatory and immunomodulatory activities. Physalin F induces apoptosis of PBMC, decreasing the spontaneous proliferation and cytokine production caused by Human T-lymphotropic virus type 1 (HTLV-1) infection[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
