Revaprazan (hydrochloride) [CAS 178307-42-1] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 178307-42-1 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 398.90 |
| Formula: | C22H24ClFN4 |
| SMILES: | CC1=C(C)C(N2C(C)C3=C(C=CC=C3)CC2)=NC(NC4=CC=C(F)C=C4)=N1.[H]Cl |
| Purity: | 99.98 |
| Description: | Revaprazan hydrochloride is a novel acid pump antagonist (APA). Revaprazan hydrochloride reduces COX-2 expression and has significant anti-inflammatory actions activities in H. pylori infection[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
