Leptomycin A [CAS 87081-36-5]
Partner: MedChemexpress LLC
| CAS No: | 87081-36-5 |
| Applications: | COVID-19-anti-virus |
| MW: | 526.70 |
| Formula: | C32H46O6 |
| SMILES: | O=C(O)/C=C(C)/C[C@H](C)[C@@H](O)[C@H](C)C([C@H](C)/C=C(C)/C=C/C[C@@H](C)/C=C(C)\C=C\[C@H]1[C@@H](C)C=CC(O1)=O)=O |
| Purity: | 99.0 |
| Description: | Leptomycin A, a Streptomyces metabolite, is an inhibitor of CRM1 (exportin 1) that blocks CRM1 interaction with nuclear export signals, preventing the nuclear export of a broad range of proteins. Leptomycin A suppresses HIV-1 replication. Less potent than Leptomycin B[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
