Beta-Zearalenol [CAS 71030-11-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 71030-11-0 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 320.38 |
| Formula: | C18H24O5 |
| SMILES: | OC1=C2C(O[C@H](CCC[C@H](CCC/C=C/C2=CC(O)=C1)O)C)=O |
| Purity: | 99.70 |
| Description: | β-Zearalenol is a non-steroidal estrogenic mycotoxin synthesized by Fusarium species. β-Zearalenol potentially influences transcription and effects gene expression on translational level[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
