Licochalcone E [CAS 864232-34-8]
Partner: MedChemexpress LLC
| CAS No: | 864232-34-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 338.40 |
| Formula: | C21H22O4 |
| SMILES: | O=C(C1=CC=C(O)C=C1)/C=C/C2=CC([C@@H](C)C(C)=C)=C(O)C=C2OC |
| Purity: | 99.63 |
| Description: | Licochalcone E, a flavonoid compound isolated from Glycyrrhiza uralensis, inhibits NF-?B and AP-1 transcriptional activity through the inhibition of AKT and MAPK activation[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
