(+)-Coclaurine (hydrochloride) [CAS 19894-19-0]
Partner: MedChemexpress LLC
| CAS No: | 19894-19-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 321.80 |
| Formula: | C17H20ClNO3 |
| SMILES: | COC(C=C(CCN1)C([C@H]1CC2=CC=C(C=C2)O)=C3)=C3O.Cl |
| Purity: | 99.43 |
| Description: | (+)-Coclaurine ((+)-(R)-Coclaurine) hydrochloride, benzyltetrahydroisoquinoline alkaloid isolated from a variety of plant sources. (+)-Coclaurine hydrochloride has anti-aging activity[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
