Pteryxin [CAS 13161-75-6]
Partner: MedChemexpress LLC
| CAS No: | 13161-75-6 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 386.40 |
| Formula: | C21H22O7 |
| SMILES: | C/C=C(C)\C(O[C@@H]1C2=C3C(C=CC(O3)=O)=CC=C2OC(C)(C)[C@@H]1OC(C)=O)=O |
| Purity: | 99.96 |
| Description: | Pteryxin, a coumarin in Peucedanum japonicum Thunb leaves, exerts antiobesity activity[1]. Pteryxin is a potent butyrylcholinesterase (BChE) inhibitor, with an IC50 of 12.96 ?g/ml[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
