Myristic acid-d27 [CAS 60658-41-5]
Partner: MedChemexpress LLC
| CAS No: | 60658-41-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 255.54 |
| Formula: | C14HD27O2 |
| SMILES: | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(O)=O |
| Purity: | 98.83 |
| Description: | Myristic acid-d27 is the deuterium labeled Myristic acid. Myristic acid is a saturated 14-carbon fatty acid occurring in most animal and vegetable fats, particularly butterfat and coconut, palm, and nutmeg oils. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
