Chebulinic acid [CAS 18942-26-2]
Partner: MedChemexpress LLC
| CAS No: | 18942-26-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 956.68 |
| Formula: | C41H32O27 |
| SMILES: | OC(C[C@H](C(O[C@@]([C@H](O[C@H]1OC(C2=CC(O)=C(O)C(O)=C2)=O)COC(C3=CC(O)=C(O)C(O)=C3)=O)([H])[C@@](OC(C4=CC(O)=C(O)C(O)=C4)=O)([H])[C@@]1([H])OC5=O)=O)[C@@]([C@H]6O)([H])C(C5=CC(O)=C7O)=C7OC6=O)=O |
| Purity: | 99.42 |
| Description: | Chebulinic acid is a potent natural inhibitor of M. tuberculosis DNA gyrase, also can inhibit SMAD-3 phosphorylation, inhibit H+ K+-ATPase activity. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
