Nevadensin [CAS 10176-66-6]
Partner: MedChemexpress LLC
| CAS No: | 10176-66-6 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 344.32 |
| Formula: | C18H16O7 |
| SMILES: | O=C1C=C(C2=CC=C(OC)C=C2)OC3=C(OC)C(O)=C(OC)C(O)=C13 |
| Purity: | 99.93 |
| Description: | Nevadensin is a naturally occurring selective inhibitor of human carboxylesterase 1 (hCE1) with an IC50 of 2.64 ?M. Nevadensin has a variety of pharmacological effects such as anti-mycobacterium tuberculosis activities, antitussive, anti-inflammatory and anti-hypertensive[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
