Eupalinolide B [CAS 877822-41-8]
Partner: MedChemexpress LLC
| CAS No: | 877822-41-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 462.49 |
| Formula: | C24H30O9 |
| SMILES: | O=C(O[C@@H]1C/C(COC(C)=O)=C/C[C@H](OC(C)=O)/C(C)=C/[C@@]([C@]1([H])C2=C)([H])OC2=O)/C(C)=C/CO |
| Purity: | 99.48 |
| Description: | Eupalinolide B is a germacrane sesquiterpene isolated from Eupatorium lindleyanum. Eupalinolide B demonstrates potent cytotoxicity against A-549, BGC-823 and HL-60 tumour cell lines[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
