Linoleic acid-d5 [CAS 1169764-58-2]
Partner: MedChemexpress LLC
| CAS No: | 1169764-58-2 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 285.48 |
| Formula: | C18H27D5O2 |
| SMILES: | O=C(O)CCCCCCC/C=C\C/C=C\CCCC([2H])([2H])C([2H])([2H])[2H] |
| Purity: | 98.0 |
| Description: | Linoleic Acid-d5 is the deuterium labeled Linoleic acid. Linoleic acid is a common polyunsaturated (PUFA) found in plant-based oils, nuts and seeds. Linoleic acid is a part of membrane phospholipids, and functions as a structural component to maintain a certain level of membrane fluidity of the transdermal water barrier of the epidermis. Linoleic acid induces red blood cells and hemoglobin damage via oxidative mechanism[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
