Morusin [CAS 62596-29-6]
Partner: MedChemexpress LLC
CAS No: | 62596-29-6 |
Applications: | Cancer-Kinase/protease |
MW: | 420.45 |
Formula: | C25H24O6 |
SMILES: | O=C1C2=C(O)C=C3C(C=CC(C)(C)O3)=C2OC(C4=CC=C(O)C=C4O)=C1C/C=C(C)\C |
Purity: | 99.94 |
Description: | Morusin is a prenylated flavonoid isolated from Morus alba Linn. with various biological activities, such as antitumor, antioxidant, and anti-bacteria property. Morusin could inhibit NF-?B and STAT3 activity. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice