Morusin [CAS 62596-29-6] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 62596-29-6 |
| Applications: | Cancer-Kinase/protease |
| MW: | 420.45 |
| Formula: | C25H24O6 |
| SMILES: | O=C1C2=C(O)C=C3C(C=CC(C)(C)O3)=C2OC(C4=CC=C(O)C=C4O)=C1C/C=C(C)\C |
| Purity: | 99.94 |
| Description: | Morusin is a prenylated flavonoid isolated from Morus alba Linn. with various biological activities, such as antitumor, antioxidant, and anti-bacteria property. Morusin could inhibit NF-?B and STAT3 activity. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
