Nomilin [CAS 1063-77-0]
Partner: MedChemexpress LLC
| CAS No: | 1063-77-0 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 514.56 |
| Formula: | C28H34O9 |
| SMILES: | C[C@]([C@@](CC1)([H])[C@]2([C@H](CC3=O)OC(C)=O)C)(C(C[C@@]2([H])C(C)(O3)C)=O)[C@@]4([C@@H]5O4)[C@@]1([C@H](C6=COC=C6)OC5=O)C |
| Purity: | 99.38 |
| Description: | Nomilin is a limonoid compound obtained from the extracts of citrus fruits. Nomilin is an anti-obesity and anti-hyperglycemic agent [1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
