(-)-Gallocatechin [CAS 3371-27-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 3371-27-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 306.27 |
| Formula: | C15H14O7 |
| SMILES: | O[C@H]1[C@H](C2=CC(O)=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C3C1 |
| Purity: | 99.97 |
| Description: | (-)-Gallocatechin, an epimer of (-)-Epigallocatechin (EGC), is contained in various tea products. (-)-Gallocatechin has antioxidant activities[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
