Cordycepin [CAS 73-03-0]
Partner: MedChemexpress LLC
| CAS No: | 73-03-0 |
| Applications: | Cancer-Kinase/protease |
| MW: | 251.24 |
| Formula: | C10H13N5O3 |
| SMILES: | OC[C@@H]1C[C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N)O1 |
| Purity: | 99.17 |
| Description: | Cordycepin (3'-Deoxyadenosine) is a nucleoside derivative and inhibits IL-1?-induced MMP-1 and MMP-3 expression in rheumatoid arthritis synovial fibroblasts (RASFs) in a dose-dependent manner[1]. Cordycepin kills Mycobacterium tuberculosis through hijacking the bacterial adenosine kinase[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
