(-)-Epigallocatechin [CAS 970-74-1]
Partner: MedChemexpress LLC
| CAS No: | 970-74-1 |
| Applications: | Cancer-Kinase/protease |
| MW: | 306.27 |
| Formula: | C15H14O7 |
| SMILES: | O[C@H]1[C@@H](C2=CC(O)=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C3C1 |
| Purity: | 98.01 |
| Description: | (-)-Epigallocatechin (Epigallocatechin) is the most abundant flavonoid in green tea, can bind to unfolded native polypeptides and prevent conversion to amyloid fibrils. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
