CM-H2DCFDA [CAS 850013-49-9]
Partner: MedChemexpress LLC
| CAS No: | 850013-49-9 |
| MW: | 577.79 |
| Formula: | C27H19Cl3O8 |
| SMILES: | CC(OC1=C(Cl)C=C2C(C3=C(C=CC(CCl)=C3)C(OC(C)=O)=O)C4=CC(Cl)=C(OC(C)=O)C=C4OC2=C1)=O.CC(OC5=C(Cl)C=C6C(C7=C(C=C(CCl)C=C7)C(OC(C)=O)=O)C8=CC(Cl)=C(OC(C)=O)C=C8OC6=C5)=O |
| Purity: | 92.0 |
| Description: | CM-H2DCFDA is a derivative of H2DCFDA (HY-D0940). CM-H2DCFDA can be used to determine cellular oxidant levels (Ex/Em: 495/530 nm). CM-H2DCFDA is light-sensitive[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
