Pyronin B [CAS 2150-48-3]
Partner: MedChemexpress LLC
CAS No: | 2150-48-3 |
MW: | 358.90 |
Formula: | C21H27ClN2O |
SMILES: | CCN(C1=CC2=[O+]C3=C(C=CC(N(CC)CC)=C3)C=C2C=C1)CC.[Cl-] |
Description: | Pyronin B is an organic cationic dye used for the staining of bacteria, mycobacteria and ribonucleic acids. Pyronin B is also used as a small hydrophobic (SH) protein channel inhibitor[1][2]. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice