5(6)-Carboxy-2',7'-dichlorofluorescein diacetate [CAS 127770-45-0]
Partner: MedChemexpress LLC
| CAS No: | 127770-45-0 |
| MW: | 529.28 |
| Formula: | C25H14Cl2O9 |
| SMILES: | ClC1=C(OC(C)=O)C=C2OC3=CC(OC(C)=O)=C(Cl)C=C3C(OC4=O)(C5=CC=C(C(O)=O)C=C54)C2=C1.ClC6=C(OC(C)=O)C=C7OC8=CC(OC(C)=O)=C(Cl)C=C8C(OC9=O)(C%10=CC(C(O)=O)=CC=C%109)C7=C6 |
| Purity: | 94.32 |
| Description: | 5(6)-Carboxy-2',7'-dichlorofluorescein diacetate is a cell permeant fluorescent indicator. 5(6)-Carboxy-2',7'-dichlorofluorescein diacetate can be used to assess reactive oxygen species (ROS) generation within human neuronal-glial (HNG) cells in primary co-culture[1] |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
