7-Methyl-6-thioguanosine [CAS 55727-10-1]
Partner: MedChemexpress LLC
| CAS No: | 55727-10-1 |
| MW: | 313.33 |
| Formula: | C11H15N5O4S |
| SMILES: | S=C1NC(N)=NC2=C1[N+](C)=CN2[C@H]3[C@@H]([C@@H]([C@@H](CO)O3)O)[O-] |
| Purity: | 99.0 |
| Description: | 7-Methyl-6-thioguanosine (MESG) is a chromophoric substrate which can be used for the quantitation of inorganic phosphate. 7-Methyl-6-thioguanosine is also used to determine the activity of purine nucleoside phosphorylase[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
