Rotenone [CAS 83-79-4] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 83-79-4 |
| Applications: | Cancer-Kinase/protease |
| MW: | 394.42 |
| Formula: | C23H22O6 |
| SMILES: | O=C1[C@]2([H])[C@](COC3=CC(OC)=C(OC)C=C32)([H])OC4=C5C(O[C@@H](C(C)=C)C5)=CC=C14 |
| Purity: | 99.65 |
| Description: | Rotenone is a mitochondrial electron transport chain complex I inhibitor. Rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
