Methenamine (hippurate) [CAS 5714-73-8]
Partner: MedChemexpress LLC
| CAS No: | 5714-73-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 319.36 |
| Formula: | C15H21N5O3 |
| SMILES: | O=C(O)CNC(C1=CC=CC=C1)=O.N2(C3)CN4CN3CN(C4)C2 |
| Purity: | 99.55 |
| Description: | Methenamine hippurate (Hexamine hippurate) is an orally active urinary antiseptic agent with a wide antibacterial spectrum. Methenamine hippurate is effective against most common urinary tract pathogens[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
