Oxprenolol (hydrochloride) [CAS 6452-73-9]
Partner: MedChemexpress LLC
| CAS No: | 6452-73-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 301.81 |
| Formula: | C15H24ClNO3 |
| SMILES: | OC(COC1=CC=CC=C1OCC=C)CNC(C)C.[H]Cl |
| Purity: | 99.86 |
| Description: | Oxprenolol hydrochloride (Ba 39089) is an orally bioavailable ?-adrenergic receptor (?-AR) antagonist with a Ki of 7.10 nM in a radioligand binding assay using rat heart muscle[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
