Mycophenolate Mofetil-d4 [CAS 1132748-21-0]
Partner: MedChemexpress LLC
| CAS No: | 1132748-21-0 |
| MW: | 437.52 |
| Formula: | C23H27D4NO7 |
| SMILES: | CC1=C2C(C(OC2)=O)=C(C(C/C=C(C)/CCC(OC([2H])([2H])C([2H])([2H])N3CCOCC3)=O)=C1OC)O |
| Purity: | 99.47 |
| Description: | Mycophenolate Mofetil-d4 is the deuterium labeled Mycophenolate Mofetil. Mycophenolate mofetil (RS 61443) is the morpholinoethylester proagent of Mycophenolic acid. Mycophenolate mofetil inhibits de novo purine synthesis via the inhibition of inosine monophosphate dehydrogenase (IMPDH). Mycophenolate mofetil shows selective lymphocyte antiproliferative effects involve both T and B cells, preventing antibody formation[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
