Ofloxacin [CAS 82419-36-1]
Partner: MedChemexpress LLC
| CAS No: | 82419-36-1 |
| Applications: | COVID-19-immunoregulation |
| MW: | 361.37 |
| Formula: | C18H20FN3O4 |
| SMILES: | O=C(C(C1=O)=CN2C(C)COC3=C(N4CCN(C)CC4)C(F)=CC1=C23)O |
| Purity: | 99.82 |
| Description: | Ofloxacin (Hoe-280) is a fluoroquinolone whose primary mechanism of action is inhibition of bacterial DNA gyrase. Ofloxacin shows inhibitory activity against vaccinia virus (VV). |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
