Rosoxacin [CAS 40034-42-2]
Partner: MedChemexpress LLC
| CAS No: | 40034-42-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 294.30 |
| Formula: | C17H14N2O3 |
| SMILES: | O=C(C1=CN(CC)C2=C(C=CC(C3=CC=NC=C3)=C2)C1=O)O |
| Purity: | 98.31 |
| Description: | Rosoxacin (Acrosoxacin) is an orally active and broad-spectrum antibacterial quinolone antibiotic. Rosoxacin inhibits Gram-negative bacteria, including N. gonorrhoeae (MIC range=0.03-0.125 �g/mL).Rosoxacin can be used in studies of urinary tract infections and certain sexually transmitted diseases[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
