Etomoxir (sodium salt) [CAS 828934-41-4]
Partner: MedChemexpress LLC
| CAS No: | 828934-41-4 |
| Applications: | Cancer-programmed cell death |
| MW: | 320.74 |
| Formula: | C15H18ClNaO4 |
| SMILES: | ClC1=CC=C(OCCCCCC[C@@]2(CO2)C(O[Na])=O)C=C1 |
| Purity: | 99.73 |
| Description: | Etomoxir((R)-(+)-Etomoxir) sodium salt is an irreversible inhibitor of carnitine palmitoyltransferase 1a (CPT-1a), inhibits fatty acid oxidation (FAO) through CPT-1a and inhibits palmitate ?-oxidation in human, rat and guinea pig[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
