Oct3/4-inducer-1 [CAS 1016535-83-3] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1016535-83-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 241.26 |
| Formula: | C15H12FNO |
| SMILES: | N#CCC1=CC=C(OCC2=CC=C(F)C=C2)C=C1 |
| Purity: | 98.04 |
| Description: | Oct3/4-inducer-1 (compound 2) is a potent Oct3/4 inducer. Oct3/4-inducer-1 promotes expression and stabilization of Oct3/4, and enhances its transcriptional activity in diverse human somatic cells[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
