SR9011 (hydrochloride) [CAS 2070014-94-5]
Partner: MedChemexpress LLC
| CAS No: | 2070014-94-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 515.50 |
| Formula: | C23H32Cl2N4O3S |
| SMILES: | O=C(N1CC(CN(CC2=CC=C(Cl)C=C2)CC3=CC=C([N+]([O-])=O)S3)CC1)NCCCCC.[H]Cl |
| Purity: | 99.39 |
| Description: | SR9011 hydrochloride is a REV-ERB?/? agonist with IC50s of 790 nM and 560 nM for REV-ERB? and REV-ERB?, respectively. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
