SR 11302 [CAS 160162-42-5]
Partner: MedChemexpress LLC
| CAS No: | 160162-42-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 376.53 |
| Formula: | C26H32O2 |
| SMILES: | O=C(O)/C=C(C)/C=C/C=C(C1=CC=C(C)C=C1)/C=C/C2=C(C)CCCC2(C)C |
| Purity: | 98.91 |
| Description: | SR 11302 is an activator protein-1 (AP-1) transcription factor inhibitor. SR 11302 is a retinoid that specifically inhibits AP-1 activity without activating the transcription of retinoic acid response element (RARE)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
