RGB-1 [CAS 930455-91-7]
Partner: MedChemexpress LLC
| CAS No: | 930455-91-7 |
| MW: | 460.49 |
| Formula: | C22H12N4O4S2 |
| SMILES: | O=C1C2=C(SC=C2C3=CC=CO3)N=C4N1CC5=NC6=C(C(N5C4)=O)C(C7=CC=CO7)=CS6 |
| Purity: | 98.07 |
| Description: | RGB-1 is a polycyclic aromatic hydrocarbon molecule and a stabilizer of RNA G-quadruplexes. RGB-1 can promote the inhibition of RNA translation and reduce the expression of NRAS proto-oncogene in breast cancer cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
