MSU-42011 [CAS 2456434-36-7]
Partner: MedChemexpress LLC
| CAS No: | 2456434-36-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 382.54 |
| Formula: | C24H34N2O2 |
| SMILES: | O=C(C1=CN=C(N(CC(C)C)C2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2)C=C1)O |
| Purity: | 98.43 |
| Description: | MSU-42011 is an orally active retinoid X receptor (RXR) agonist. MSU-42011 inhibits the iNOS activity and reduces the expression of p-ERK protein. MSU-42011 has immunomodulatory and antitumor activity[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
