G3-CNP [CAS 118291-90-0]
Partner: MedChemexpress LLC
| CAS No: | 118291-90-0 |
| MW: | 659.98 |
| Formula: | C24H34ClNO18 |
| SMILES: | OC[C@@H](O[C@@H]([C@@H]([C@H]1O)O)OC2=C(C=C(C=C2)[N+]([O-])=O)Cl)[C@H]1O[C@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O[C@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)CO |
| Purity: | 99.62 |
| Description: | G3-CNP is an ?-amylase substrate. The absorbance of G3-CNP cleavage product 2-chloro-4-nitrophenol is measured at 405 nm, which can be used to detect enzyme activity[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
