NP-1815-PX (sodium) [CAS 1239578-80-3]
Partner: MedChemexpress LLC
| CAS No: | 1239578-80-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 424.41 |
| Formula: | C21H13N4NaO3S |
| SMILES: | O=C1NC2=C(N(C(C1)=O)C3=CC=CC(C4=NOC(N4[Na])=S)=C3)C=CC5=C2C=CC=C5 |
| Purity: | 99.62 |
| Description: | NP-1815-PX sodium is a potent and selective P2X4R antagonist. NP-1815-PX sodium has anti-inflammatory activity, and can relieve pain in chronic pain models. NP-1815-PX sodium also inhibits guinea pig tracheal/bronchial smooth muscle (TSM and BSM) contractions[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
